WAY 213613 structure
|
Common Name | WAY 213613 | ||
|---|---|---|---|---|
| CAS Number | 868359-05-1 | Molecular Weight | 415.19 | |
| Density | 1.665g/cm3 | Boiling Point | 565.634ºC at 760 mmHg | |
| Molecular Formula | C16H13BrF2N2O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 295.885ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of WAY 213613WAY-213613 is a potent, selective human EAAT2 inhibitor (IC50, 85 nM), exhibits 59- and 45-fold selectivity over human EAAT1 and EAAT3. Inhibits glutamate uptake in rat cortical synaptosomes[1]. |
| Name | (2S)-2-amino-4-[4-(2-bromo-4,5-difluorophenoxy)anilino]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | WAY-213613 is a potent, selective human EAAT2 inhibitor (IC50, 85 nM), exhibits 59- and 45-fold selectivity over human EAAT1 and EAAT3. Inhibits glutamate uptake in rat cortical synaptosomes[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 85 nM (Human EAAT2), 3.8 μM (Human EAAT3), 5 μM (Human EAAT1)[1] |
| In Vitro | WAY-213613 exhibits IC50s of 5 and 3.8 μM for EAAT1 and EAAT3, respectively[1]. |
| References |
| Density | 1.665g/cm3 |
|---|---|
| Boiling Point | 565.634ºC at 760 mmHg |
| Molecular Formula | C16H13BrF2N2O4 |
| Molecular Weight | 415.19 |
| Flash Point | 295.885ºC |
| Exact Mass | 414.00300 |
| PSA | 101.65000 |
| LogP | 4.03340 |
| Index of Refraction | 1.632 |
| InChIKey | BNYDDAAZMBUFRG-ZDUSSCGKSA-N |
| SMILES | NC(CC(=O)Nc1ccc(Oc2cc(F)c(F)cc2Br)cc1)C(=O)O |
| way-213,613 |