N-(3-Formyl-2-pyridinyl)-2,2-dimethylpropanamide structure
|
Common Name | N-(3-Formyl-2-pyridinyl)-2,2-dimethylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 86847-64-5 | Molecular Weight | 206.241 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 406.1±30.0 °C at 760 mmHg | |
| Molecular Formula | C11H14N2O2 | Melting Point | 85-88°C | |
| MSDS | Chinese | Flash Point | 199.4±24.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | n-(3-formyl-2-pyridinyl)-2,2-dimethylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.1±30.0 °C at 760 mmHg |
| Melting Point | 85-88°C |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.241 |
| Flash Point | 199.4±24.6 °C |
| Exact Mass | 206.105530 |
| PSA | 59.06000 |
| LogP | 2.38 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | ANABHCSYKASRRW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Nc1ncccc1C=O |
| Storage condition | 2-8℃ |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
|
~92%
N-(3-Formyl-2-p... CAS#:86847-64-5 |
| Literature: Dr. Karl Thomae GmbH Patent: US6344449 B1, 2002 ; Location in patent: Page column 130-131 ; |
|
~83%
N-(3-Formyl-2-p... CAS#:86847-64-5 |
| Literature: Eisai RandD Management Co., Ltd. Patent: EP1782811 A1, 2007 ; Location in patent: Page/Page column 59 ; |
|
~86%
N-(3-Formyl-2-p... CAS#:86847-64-5 |
| Literature: Eisai Co., Ltd. Patent: EP1669348 A1, 2006 ; Location in patent: Page/Page column 67 ; |
|
~%
N-(3-Formyl-2-p... CAS#:86847-64-5 |
| Literature: EP1218005 B1, ; Page 21 ; |
|
~%
N-(3-Formyl-2-p... CAS#:86847-64-5 |
| Literature: US4906629 A1, ; |
|
~%
N-(3-Formyl-2-p... CAS#:86847-64-5 |
| Literature: Synthetic Communications, , vol. 31, # 10 p. 1573 - 1579 |
|
~%
N-(3-Formyl-2-p... CAS#:86847-64-5 |
| Literature: Journal of Organic Chemistry, , vol. 48, # 20 p. 3401 - 3408 |
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(3-Formyl-2-pyridinyl)-2,2-dimethylpropanamide |
| N-(3-Formylpyridin-2-yl)-2,2-dimethylpropanamide |
| MFCD01830170 |
| Propanamide, N-(3-formyl-2-pyridinyl)-2,2-dimethyl- |