N-[(2S)-2-(Glycoloylamino)-4-phenylbutanoyl]-L-leucyl-N-{(2S)-4-methyl-1-[(2R)-2-methyl-2-oxiranyl]-1-oxo-2-pentanyl}-L-phenylalaninamide structure
|
Common Name | N-[(2S)-2-(Glycoloylamino)-4-phenylbutanoyl]-L-leucyl-N-{(2S)-4-methyl-1-[(2R)-2-methyl-2-oxiranyl]-1-oxo-2-pentanyl}-L-phenylalaninamide | ||
|---|---|---|---|---|
| CAS Number | 868540-02-7 | Molecular Weight | 650.80 | |
| Density | 1.177±0.06 g/cm3(Predicted) | Boiling Point | 953.7±65.0 °C(Predicted) | |
| Molecular Formula | C36H50N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-[(2S)-2-(Glycoloylamino)-4-phenylbutanoyl]-L-leucyl-N-{(2S)-4-methyl-1-[(2R)-2-methyl-2-oxiranyl]-1-oxo-2-pentanyl}-L-phenylalaninamideEnzyme-IN-1 (compound 1) is a peptide-based inhibitor of N-terminal nucleophile (Ntn) hydrolases. Specifically, Enzyme-IN-1 inhibits the chymotrypsin-like activity (CT-L) of the 20S proteasome. Enzyme-IN-1 may has potential antiinflammatory properties[1]. |
| Name | Enzyme-IN-1 |
|---|
| Description | Enzyme-IN-1 (compound 1) is a peptide-based inhibitor of N-terminal nucleophile (Ntn) hydrolases. Specifically, Enzyme-IN-1 inhibits the chymotrypsin-like activity (CT-L) of the 20S proteasome. Enzyme-IN-1 may has potential antiinflammatory properties[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.177±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 953.7±65.0 °C(Predicted) |
| Molecular Formula | C36H50N4O7 |
| Molecular Weight | 650.80 |
| InChIKey | FPEULINZOIPWNM-VBBSPCATSA-N |
| SMILES | CC(C)CC(NC(=O)C(CCc1ccccc1)NC(=O)CO)C(=O)NC(Cc1ccccc1)C(=O)NC(CC(C)C)C(=O)C1(C)CO1 |
| Storage condition | 2-8°C |