(3-diethylaminophenyl) N-[3-(trifluoromethyl)phenyl]carbamate structure
|
Common Name | (3-diethylaminophenyl) N-[3-(trifluoromethyl)phenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 86927-99-3 | Molecular Weight | 352.35100 | |
| Density | 1.263g/cm3 | Boiling Point | 413.5ºC at 760 mmHg | |
| Molecular Formula | C18H19F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.9ºC | |
| Name | [3-(diethylamino)phenyl] N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 413.5ºC at 760 mmHg |
| Molecular Formula | C18H19F3N2O2 |
| Molecular Weight | 352.35100 |
| Flash Point | 203.9ºC |
| Exact Mass | 352.14000 |
| PSA | 41.57000 |
| LogP | 5.23550 |
| Index of Refraction | 1.563 |
| InChIKey | ODHNGPQWAMSPCZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1cccc(OC(=O)Nc2cccc(C(F)(F)F)c2)c1 |
|
~86%
(3-diethylamino... CAS#:86927-99-3 |
| Literature: Cegan; Vecere Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 5 p. 1440 - 1446 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (3-diethylaminophenyl) N-[3-(trifluoromethyl)phenyl]carbamate |