4-(Benzyloxy)benzenesulfonyl chloride structure
|
Common Name | 4-(Benzyloxy)benzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 87001-32-9 | Molecular Weight | 282.743 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 427.0±20.0 °C at 760 mmHg | |
| Molecular Formula | C13H11ClO3S | Melting Point | 0ºC | |
| MSDS | N/A | Flash Point | 212.0±21.8 °C | |
| Name | 4-(Benzyloxy)benzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 427.0±20.0 °C at 760 mmHg |
| Melting Point | 0ºC |
| Molecular Formula | C13H11ClO3S |
| Molecular Weight | 282.743 |
| Flash Point | 212.0±21.8 °C |
| Exact Mass | 282.011749 |
| PSA | 51.75000 |
| LogP | 4.16 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | BRTDEKQMIKCPKH-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(OCc2ccccc2)cc1 |
| Risk Phrases | 34 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3261 |
| HS Code | 2909309090 |
|
~97%
4-(Benzyloxy)be... CAS#:87001-32-9 |
| Literature: Liu, Juntao; Zhou, Yougui; Wu, Yinuo; Li, Xingshu; Chan, Albert S.C. Tetrahedron Asymmetry, 2008 , vol. 19, # 7 p. 832 - 837 |
|
~%
4-(Benzyloxy)be... CAS#:87001-32-9 |
| Literature: US5872138 A1, ; US 5872138 A |
|
~99%
4-(Benzyloxy)be... CAS#:87001-32-9 |
| Literature: Brinner, Kristin M; Mi Kim, Jin; Habashita, Hiromu; Gluzman, Ilya Y; Goldberg, Daniel E; Ellman, Jonathan A Bioorganic and Medicinal Chemistry, 2002 , vol. 10, # 11 p. 3649 - 3661 |
|
~%
4-(Benzyloxy)be... CAS#:87001-32-9 |
| Literature: WO2006/10629 A1, ; Page/Page column 63-64 ; WO 2006/010629 A1 |
|
~%
4-(Benzyloxy)be... CAS#:87001-32-9 |
| Literature: Organic and Biomolecular Chemistry, , vol. 3, # 14 p. 2513 - 2518 |
|
~%
4-(Benzyloxy)be... CAS#:87001-32-9 |
| Literature: European Journal of Medicinal Chemistry, , vol. 26, # 4 p. 403 - 413 |
|
~%
4-(Benzyloxy)be... CAS#:87001-32-9 |
| Literature: US6329397 B1, ; US 6329397 B1 |
|
~%
4-(Benzyloxy)be... CAS#:87001-32-9 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 10, # 11 p. 3649 - 3661 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-(Benzyloxy)benzenesulfonyl chloride |
| 4-(benzyloxy)benzene-1-sulfonyl chloride |
| 4-phenylmethoxybenzenesulfonyl chloride |
| Benzenesulfonyl chloride, 4-(phenylmethoxy)- |