4-Amino-1-Boc-piperidine structure
|
Common Name | 4-Amino-1-Boc-piperidine | ||
|---|---|---|---|---|
| CAS Number | 87120-72-7 | Molecular Weight | 200.278 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 277.3±33.0 °C at 760 mmHg | |
| Molecular Formula | C10H20N2O2 | Melting Point | 50°C | |
| MSDS | Chinese USA | Flash Point | 121.5±25.4 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 4-Amino-1-Boc-piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 277.3±33.0 °C at 760 mmHg |
| Melting Point | 50°C |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.278 |
| Flash Point | 121.5±25.4 °C |
| Exact Mass | 200.152481 |
| PSA | 55.56000 |
| LogP | 0.67 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.484 |
| InChIKey | LZRDHSFPLUWYAX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)CC1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36/37/39-S22-S222636/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| HS Code | 2933399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Annulation of primary amines to piperazines and diazaspirocycles utilizing alpha-methyl benzyl resin.
J. Comb. Chem. 8 , 132, (2006) The microwave-assisted solid-phase synthesis of piperazines, 3,9-diazaspiro[5.5]undecanes and 2,9-diazaspiro[5.5]undecanes is reported. The synthesis relies on the direct annulation of primary amines ... |
| 2-Methyl-2-propanyl 4-amino-1-piperidinecarboxylate |
| tert-butyl 4-aminopiperidine-1-carboxylate |
| MFCD01076201 |
| N-BOC-4-amino-piperidine |