1,6-Bis(Trimethoxysilyl)Hexane structure
|
Common Name | 1,6-Bis(Trimethoxysilyl)Hexane | ||
|---|---|---|---|---|
| CAS Number | 87135-01-1 | Molecular Weight | 326.534 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 283.7±23.0 °C at 760 mmHg | |
| Molecular Formula | C12H30O6Si2 | Melting Point | <0°C | |
| MSDS | N/A | Flash Point | 108.4±23.0 °C | |
| Name | trimethoxy(6-trimethoxysilylhexyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 283.7±23.0 °C at 760 mmHg |
| Melting Point | <0°C |
| Molecular Formula | C12H30O6Si2 |
| Molecular Weight | 326.534 |
| Flash Point | 108.4±23.0 °C |
| Exact Mass | 326.158081 |
| PSA | 55.38000 |
| LogP | 1.64 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.423 |
| InChIKey | GFKCWAROGHMSTC-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCCCC[Si](OC)(OC)OC)(OC)OC |
| Storage condition | 2~8℃,Seal |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 3,3,10,10-Tetramethoxy-2,11-dioxa-3,10-disiladodecane |
| 2,11-Dioxa-3,10-disiladodecane, 3,3,10,10-tetramethoxy- |
| 1,6-BIS(TRIMETHOXYSILYL)HEXANE |
| 1O-SI-O1&O1&6-SI-O1&O1&O1 |
| 2,11-Dioxa-3,10-disiladodecane,3,3,10,10-tetramethoxy |