2,4-Bis(2-methyl-2-propanyl)-5-nitrophenol structure
|
Common Name | 2,4-Bis(2-methyl-2-propanyl)-5-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 873055-57-3 | Molecular Weight | 251.321 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 337.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.6±16.3 °C | |
| Name | 2,4-ditert-butyl-5-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 337.9±42.0 °C at 760 mmHg |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.321 |
| Flash Point | 133.6±16.3 °C |
| Exact Mass | 251.152145 |
| PSA | 66.05000 |
| LogP | 5.30 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | VIWYWRSFQRIVPI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c([N+](=O)[O-])cc1O |
| Storage condition | 2~8℃ |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2908999090 |
|
~29%
2,4-Bis(2-methy... CAS#:873055-57-3 |
| Literature: Vertex Pharmaceuticals Incorported Patent: US2011/98311 A1, 2011 ; |
|
~%
2,4-Bis(2-methy... CAS#:873055-57-3 |
| Literature: VERTEX PHARMACEUTICALS INCORPORATED Patent: US2010/168094 A1, 2010 ; Location in patent: Page/Page column 72; 73 ; US 20100168094 A1 |
|
~%
2,4-Bis(2-methy... CAS#:873055-57-3 |
| Literature: Vertex Pharmaceuticals Incorported Patent: US2011/98311 A1, 2011 ; |
|
~%
2,4-Bis(2-methy... CAS#:873055-57-3 |
| Literature: Vertex Pharmaceuticals Incorported Patent: US2011/98311 A1, 2011 ; |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,4-Bis(2-methyl-2-propanyl)-5-nitrophenol |
| 2,4-di-tert-butyl-5-nitrophenol |
| ditertbutylnitrophenol |
| MFCD11052606 |
| HE-0089 |
| Phenol, 2,4-bis(1,1-dimethylethyl)-5-nitro- |