butyl N-(4-nitrophenyl)carbamate structure
|
Common Name | butyl N-(4-nitrophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 87457-99-6 | Molecular Weight | 238.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butyl N-(4-nitrophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14N2O4 |
|---|---|
| Molecular Weight | 238.24000 |
| Exact Mass | 238.09500 |
| PSA | 84.15000 |
| LogP | 3.53960 |
| InChIKey | FWMIXGBPRUFSQN-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)Nc1ccc([N+](=O)[O-])cc1 |
|
~%
butyl N-(4-nitr... CAS#:87457-99-6 |
| Literature: Shriner; Cox Journal of the American Chemical Society, 1931 , vol. 53, p. 1602 |
|
~%
butyl N-(4-nitr... CAS#:87457-99-6 |
| Literature: Perveen, Shahnaz; Yasmin, Arfa; Khan, Khalid Mohammed Natural Product Research, 2010 , vol. 24, # 1 p. 18 - 23 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| butoxy-N-(4-nitrophenyl)carboxamide |
| (4-Nitro-phenyl)-carbamidsaeure-butylester |
| (4-nitro-phenyl)-carbamic acid butyl ester |