heptyl N-(4-nitrophenyl)carbamate structure
|
Common Name | heptyl N-(4-nitrophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 92374-99-7 | Molecular Weight | 280.32000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | heptyl N-(4-nitrophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20N2O4 |
|---|---|
| Molecular Weight | 280.32000 |
| Exact Mass | 280.14200 |
| PSA | 84.15000 |
| LogP | 4.70990 |
| InChIKey | PJOBNIUGOZOAFD-UHFFFAOYSA-N |
| SMILES | CCCCCCCOC(=O)Nc1ccc([N+](=O)[O-])cc1 |
|
~%
heptyl N-(4-nit... CAS#:92374-99-7 |
| Literature: Shriner; Cox Journal of the American Chemical Society, 1931 , vol. 53, p. 1602 |
| p-Nitro carbanilic acid,n-heptyl ester |