hexyl N-(4-nitrophenyl)carbamate structure
|
Common Name | hexyl N-(4-nitrophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 87458-01-3 | Molecular Weight | 266.29300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | hexyl N-(4-nitrophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H18N2O4 |
|---|---|
| Molecular Weight | 266.29300 |
| Exact Mass | 266.12700 |
| PSA | 84.15000 |
| LogP | 4.31980 |
| InChIKey | OFSOQJSHCDPUIU-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)Nc1ccc([N+](=O)[O-])cc1 |
|
~%
hexyl N-(4-nitr... CAS#:87458-01-3 |
| Literature: Shriner; Cox Journal of the American Chemical Society, 1931 , vol. 53, p. 1602 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (4-nitro-phenyl)-carbamic acid hexyl ester |
| Carbamic acid,(4-nitrophenyl)-,hexyl ester |
| (4-Nitro-phenyl)-carbamidsaeure-hexylester |
| p-Nitro carbanilic acid,n-hexyl ester |