pentyl N-(4-nitrophenyl)carbamate structure
|
Common Name | pentyl N-(4-nitrophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 90429-36-0 | Molecular Weight | 252.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | pentyl N-(4-nitrophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16N2O4 |
|---|---|
| Molecular Weight | 252.26600 |
| Exact Mass | 252.11100 |
| PSA | 84.15000 |
| LogP | 3.92970 |
| InChIKey | PAXRUOYAZXQGOI-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)Nc1ccc([N+](=O)[O-])cc1 |
|
~%
pentyl N-(4-nit... CAS#:90429-36-0 |
| Literature: Shriner; Cox Journal of the American Chemical Society, 1931 , vol. 53, p. 1602 |
| (4-nitro-phenyl)-carbamic acid pentyl ester |
| <4-Nitro-phenyl>-carbamidsaeure-pentylester |
| p-Nitro carbanilic acid,n-pentyl ester |
| Carbamic acid,(4-nitrophenyl)-,pentyl ester |