hydroxyl(4-phenylbutyl)pjosphinyl]benzyl acetate structure
|
Common Name | hydroxyl(4-phenylbutyl)pjosphinyl]benzyl acetate | ||
|---|---|---|---|---|
| CAS Number | 87460-09-1 | Molecular Weight | 346.357 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 581.6±43.0 °C at 760 mmHg | |
| Molecular Formula | C19H23O4P | Melting Point | 65-67ºC | |
| MSDS | N/A | Flash Point | 305.5±28.2 °C | |
| Name | Benzyl Hydroxy(4-Phenylbutyl)Phosphinoylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 581.6±43.0 °C at 760 mmHg |
| Melting Point | 65-67ºC |
| Molecular Formula | C19H23O4P |
| Molecular Weight | 346.357 |
| Flash Point | 305.5±28.2 °C |
| Exact Mass | 346.133392 |
| PSA | 73.41000 |
| LogP | 4.65 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | GVDMCYBWLREELG-UHFFFAOYSA-N |
| SMILES | O=C(CP(=O)(O)CCCCc1ccccc1)OCc1ccccc1 |
| Storage condition | -20?C Freezer |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R41 |
| Safety Phrases | 26-36/39 |
| HS Code | 2918990090 |
|
~62%
hydroxyl(4-phen... CAS#:87460-09-1 |
| Literature: Zambon Group S.p.A. Patent: US5739123 A1, 1998 ; US 5739123 A |
|
~%
hydroxyl(4-phen... CAS#:87460-09-1 |
| Literature: US4396772 A1, ; US 4396772 A |
|
~%
hydroxyl(4-phen... CAS#:87460-09-1 |
| Literature: US4602092 A1, ; |
|
~%
hydroxyl(4-phen... CAS#:87460-09-1 |
| Literature: Tetrahedron Letters, , vol. 25, # 42 p. 4737 - 4740 |
|
~%
hydroxyl(4-phen... CAS#:87460-09-1 |
| Literature: Tetrahedron Letters, , vol. 25, # 42 p. 4737 - 4740 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2-oxo-2-phenylmethoxyethyl)-(4-phenylbutyl)phosphinic acid |
| Acetic acid, 2-[hydroxy(4-phenylbutyl)phosphinyl]-, phenylmethyl ester |
| Phenylmethyl 2-[hydroxy(4-phenylbutyl)phosphinyl]acetate |
| MFCD09033183 |
| hydroxyl(4-phenylbutyl)pjosphinyl]benzyl acetate |
| EINECS 416-050-5 |
| [2-(Benzyloxy)-2-oxoethyl](4-phenylbutyl)phosphinic acid |
| R4PQO&1VO1R |