CHEMBRDG-BB 4010373
Modify Date: 2025-08-26 18:59:35
CHEMBRDG-BB 4010373 structure
|
Common Name | CHEMBRDG-BB 4010373 | ||
|---|---|---|---|---|
| CAS Number | 876716-32-4 | Molecular Weight | 218.21200 | |
| Density | 1.4g/cm3 | Boiling Point | 482.9ºC at 760 mmHg | |
| Molecular Formula | C10H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.8ºC | |
| Name | 2-(5-methyltetrazol-1-yl)-2-phenylacetic acid |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 482.9ºC at 760 mmHg |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.21200 |
| Flash Point | 245.8ºC |
| Exact Mass | 218.08000 |
| PSA | 80.90000 |
| LogP | 0.65550 |
| Index of Refraction | 1.672 |
| InChIKey | VDKQTPYMKLCTBJ-UHFFFAOYSA-N |
| SMILES | Cc1nnnn1C(C(=O)O)c1ccccc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |