Trandolaprilat structure
|
Common Name | Trandolaprilat | ||
|---|---|---|---|---|
| CAS Number | 87679-71-8 | Molecular Weight | 402.48400 | |
| Density | 1.247 g/cm3 | Boiling Point | 640.5ºC at 760 mmHg | |
| Molecular Formula | C22H30N2O5 | Melting Point | 132-134ºC | |
| MSDS | N/A | Flash Point | 341.2ºC | |
Use of TrandolaprilatTrandolaprilate is a potent angiotensin-converting enzyme (ACE) inhibitor. Trandolaprilate partially inhibits angiotensin-I-mediated c-fos induction. Trandolaprilate is main bioactive metabolite of Trandolapril. Trandolaprilate shows high lipophilicity[1][2]. |
| Name | (2S,3aR,7aS)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Trandolaprilate is a potent angiotensin-converting enzyme (ACE) inhibitor. Trandolaprilate partially inhibits angiotensin-I-mediated c-fos induction. Trandolaprilate is main bioactive metabolite of Trandolapril. Trandolaprilate shows high lipophilicity[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.247 g/cm3 |
|---|---|
| Boiling Point | 640.5ºC at 760 mmHg |
| Melting Point | 132-134ºC |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.48400 |
| Flash Point | 341.2ºC |
| Exact Mass | 402.21500 |
| PSA | 106.94000 |
| LogP | 2.62360 |
| InChIKey | AHYHTSYNOHNUSH-HXFGRODQSA-N |
| SMILES | CC(NC(CCc1ccccc1)C(=O)O)C(=O)N1C(C(=O)O)CC2CCCCC21 |
| Storage condition | -20°C Freezer |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 29339900 |
| Trandolaprilat |
| Trandolaprilatum |
| Trandolaprilate [INN-French] |
| Trandolaprilatum [INN-Latin] |
| Trandolaprilate |
| UNII-RR6866VL0O |