1-Boc-2-(hydroxydimethylsilyl)pyrrole structure
|
Common Name | 1-Boc-2-(hydroxydimethylsilyl)pyrrole | ||
|---|---|---|---|---|
| CAS Number | 879904-82-2 | Molecular Weight | 241.35900 | |
| Density | 1.03g/cm3 | Boiling Point | 317.1ºC at 760 mmHg | |
| Molecular Formula | C11H19NO3Si | Melting Point | 53-57ºC | |
| MSDS | N/A | Flash Point | 145.6ºC | |
| Name | tert-butyl 2-[hydroxy(dimethyl)silyl]pyrrole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 317.1ºC at 760 mmHg |
| Melting Point | 53-57ºC |
| Molecular Formula | C11H19NO3Si |
| Molecular Weight | 241.35900 |
| Flash Point | 145.6ºC |
| Exact Mass | 241.11300 |
| PSA | 51.46000 |
| LogP | 1.67570 |
| Index of Refraction | 1.481 |
| InChIKey | RLDVDBYGGISJNL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)n1cccc1[Si](C)(C)O |
| Storage condition | 2-8°C |
|
~50%
1-Boc-2-(hydrox... CAS#:879904-82-2 |
| Literature: Denmark, Scott E.; Baird, John D.; Regens, Christopher S. Journal of Organic Chemistry, 2008 , vol. 73, # 4 p. 1440 - 1455 |
|
~%
1-Boc-2-(hydrox... CAS#:879904-82-2 |
| Literature: Organic Letters, , vol. 8, # 4 p. 793 - 795 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Boc-2-(hydroxydimethylsilyl)pyrrole |
| AMTSi044 |
| MFCD08457657 |
| N-Boc-2-Hydroxydimethylsilanyl-pyrrole |
| 1-Boc-2-(Dimethylhydroxysilane)pyrrole |
| N-Boc-dimethyl(2-pyrrolyl)silanol |
| (N-Boc-2-pyrrolyl)dimethylsilanol |
| 2-(hydroxydimethylsilyl)-1H-pyrrole-1-carboxylic acid 1,1-dimethylethyl ester |