1-Boc-2-Isopropylpiperazine structure
|
Common Name | 1-Boc-2-Isopropylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 886766-25-2 | Molecular Weight | 228.331 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 298.4±15.0 °C at 760 mmHg | |
| Molecular Formula | C12H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.2±20.4 °C | |
| Name | 1-Boc-2-Isopropylpiperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 298.4±15.0 °C at 760 mmHg |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.331 |
| Flash Point | 134.2±20.4 °C |
| Exact Mass | 228.183777 |
| PSA | 41.57000 |
| LogP | 1.92 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | NZTWGWFHWJARJX-UHFFFAOYSA-N |
| SMILES | CC(C)C1CNCCN1C(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 2-propan-2-ylpiperazine-1-carboxylate |