2-Amino-4-chlorophenol-6-sulfonic acid
Modify Date: 2025-08-23 18:14:56
2-Amino-4-chlorophenol-6-sulfonic acid structure
|
Common Name | 2-Amino-4-chlorophenol-6-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 88-23-3 | Molecular Weight | 223.634 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 150 °C4 mm Hg(lit.) | |
| Molecular Formula | C6H6ClNO4S | Melting Point | 44-45 °C(lit.) | |
| MSDS | N/A | Flash Point | >230 °F | |
| Name | 2-Amino-4-chlorophenol-6-sulfonic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 150 °C4 mm Hg(lit.) |
| Melting Point | 44-45 °C(lit.) |
| Molecular Formula | C6H6ClNO4S |
| Molecular Weight | 223.634 |
| Flash Point | >230 °F |
| Exact Mass | 222.970612 |
| PSA | 109.00000 |
| LogP | 0.94 |
| Index of Refraction | 1.678 |
| InChIKey | YCTAOQGPWNTYJE-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)cc(S(=O)(=O)O)c1O |
| Hazard Codes | T |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | S22-S24/25-S26 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2922299090 |
|
~%
2-Amino-4-chlor... CAS#:88-23-3 |
| Literature: DE194935 ; Privatmitteilung DE144618 ; |
|
~%
2-Amino-4-chlor... CAS#:88-23-3 |
| Literature: DE132423 ; |
|
~%
2-Amino-4-chlor... CAS#:88-23-3 |
| Literature: DE194935 ; |
CAS#:6528-45-6
CAS#:64037-29-2| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00035768 |
| EINECS 201-813-5 |
| 3-Amino-5-chloro-2-hydroxybenzenesulfonic acid |
| Benzenesulfonic acid, 3-amino-5-chloro-2-hydroxy- |
| 2-Amino-4-chlorophenol-6-sulfonic acid |