4-tert-butyl-2,2,4,6-tetramethylhept-5-en-3-one structure
|
Common Name | 4-tert-butyl-2,2,4,6-tetramethylhept-5-en-3-one | ||
|---|---|---|---|---|
| CAS Number | 88036-45-7 | Molecular Weight | 224.38200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H28O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butyl-2,2,4,6-tetramethylhept-5-en-3-one |
|---|
| Molecular Formula | C15H28O |
|---|---|
| Molecular Weight | 224.38200 |
| Exact Mass | 224.21400 |
| PSA | 17.07000 |
| LogP | 4.62020 |
| InChIKey | NMYXSIMCAMYEED-UHFFFAOYSA-N |
| SMILES | CC(C)=CC(C)(C(=O)C(C)(C)C)C(C)(C)C |
|
~20%
4-tert-butyl-2,... CAS#:88036-45-7
Detail
|
| Literature: Wolff,S.; Agosta,W.C. Journal of the American Chemical Society, 1984 , vol. 106, p. 2363 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |