Cefepime structure
|
Common Name | Cefepime | ||
|---|---|---|---|---|
| CAS Number | 88040-23-7 | Molecular Weight | 480.561 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24N6O5S2 | Melting Point | 150ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of CefepimeCefepime is a Cephalosporin with activity against both Gram-positive and Gram-negative aerobic bacteria. Cefepime exerts its antibacterial effects by binding to penicillin-binding proteins[1]. Cefepime has certain neurotoxicity[2]. |
| Name | cefepime |
|---|---|
| Synonym | More Synonyms |
| Description | Cefepime is a Cephalosporin with activity against both Gram-positive and Gram-negative aerobic bacteria. Cefepime exerts its antibacterial effects by binding to penicillin-binding proteins[1]. Cefepime has certain neurotoxicity[2]. |
|---|---|
| Related Catalog | |
| Target |
Gram-positive and Gram-negative aerobic bacteria[1] |
| References |
[2]. B A Cunha, et al. Cefepime. Med Clin North Am. 1995 Jul;79(4):721-32. |
| Melting Point | 150ºC |
|---|---|
| Molecular Formula | C19H24N6O5S2 |
| Molecular Weight | 480.561 |
| Exact Mass | 480.124969 |
| PSA | 203.58000 |
| LogP | -1.62 |
| InChIKey | HVFLCNVBZFFHBT-CXAGYDPISA-N |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)[O-])=C(C[N+]3(C)CCCC3)CSC12)c1csc(N)n1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 7-16-53-45-36/37 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 3 |
| RTECS | CX9850000 |
| HS Code | 32041300 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 32041300 |
|---|
| 7-[(Z)-2-(2-aminothiazol-4-yl)-2-methoxyiminoacetamido]-3-(1-methylpyrrolidino)methyl-3-cephem-4-carboxylate |
| (6R,7R)-7-[2-(2-amino-4-thiazolyl)-2-(Z)-(methoxyimino)acetamido]-3-[(1-methyl-1-pyrrolidinium)methyl]-3-cephem-4-carboxylate |
| MFCD00864890 |
| Pyrrolidinium, 1-[[(6R,7R)-7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)-1-oxoethyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-1-methyl-, inner salt |
| [6R-[6a,7b(Z)]]-1-[[7-[[(2-Amino-4-thiazolyl)(methoxyimino)acetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-1-methylpyrrolidinium inner salt |
| Cefepime |
| Cefpim |
| CEFEPIME ARGININE |
| (6R,7R)-7-{[(2Z)-2-(2-Amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-[(1-methyl-1-pyrrolidiniumyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| Tsefepim |
| (6R,7R)-7-{[(2Z)-2-(2-Amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-[(1-methylpyrrolidinium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| CFPM |