Fmoc-amino-PEG5-acid structure
|
Common Name | Fmoc-amino-PEG5-acid | ||
|---|---|---|---|---|
| CAS Number | 882847-32-7 | Molecular Weight | 531.59500 | |
| Density | 1.210±0.06 g/cm3 (20ºC 760 Torr) | Boiling Point | 711.4±60.0°C at 760 mmHg | |
| Molecular Formula | C28H37NO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-amino-PEG5-acidFmoc-amino-PEG5-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16,19-hexaoxa-4-azadocosan-22-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-amino-PEG5-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.210±0.06 g/cm3 (20ºC 760 Torr) |
|---|---|
| Boiling Point | 711.4±60.0°C at 760 mmHg |
| Molecular Formula | C28H37NO9 |
| Molecular Weight | 531.59500 |
| Exact Mass | 531.24700 |
| PSA | 121.78000 |
| LogP | 3.47370 |
| InChIKey | TWQTXZPTZPOEEB-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| HS Code | 29225090 |
|---|
| fmoc-18-amino-4,7,10,13,16-pentaoxaoctadecanoic acid |
| 5,8,11,14,17-Pentaoxa-2-azaeicosanedioic acid 1-(9H-fluoren-9-ylmethyl) ester |