FBPase-1 Inhibitor structure
|
Common Name | FBPase-1 Inhibitor | ||
|---|---|---|---|---|
| CAS Number | 883973-99-7 | Molecular Weight | 377.63000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7Cl3N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FBPase-1 InhibitorFBPase-1 inhibitor-1 (compound 1) is a novel allosteric inhibitor of fructose-1,6-bisphosphatase (FBPase-1)[1]. |
| Name | Benzenesulfonamide, 2,5-dichloro-N-(5-chloro-2-benzoxazolyl) |
|---|---|
| Synonym | More Synonyms |
| Description | FBPase-1 inhibitor-1 (compound 1) is a novel allosteric inhibitor of fructose-1,6-bisphosphatase (FBPase-1)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C13H7Cl3N2O3S |
|---|---|
| Molecular Weight | 377.63000 |
| Exact Mass | 375.92400 |
| PSA | 80.58000 |
| LogP | 5.74260 |
| InChIKey | JCXZHFCBNFFHRC-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1nc2cc(Cl)ccc2o1)c1cc(Cl)ccc1Cl |
| fbpase-1 inhibitor |