2-Guanidino-3-phenylpropanoic acid structure
|
Common Name | 2-Guanidino-3-phenylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 88728-27-2 | Molecular Weight | 207.22900 | |
| Density | 1.31g/cm3 | Boiling Point | 408.4ºC at 760 mmHg | |
| Molecular Formula | C10H13N3O2 | Melting Point | 250ºC | |
| MSDS | N/A | Flash Point | 200.8ºC | |
| Name | (S)-2-Guanidino-3-phenylpropionic acid, 95% |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 408.4ºC at 760 mmHg |
| Melting Point | 250ºC |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.22900 |
| Flash Point | 200.8ºC |
| Exact Mass | 207.10100 |
| PSA | 99.20000 |
| LogP | 1.35630 |
| Index of Refraction | 1.608 |
| InChIKey | MVTHUEOHHHQQKY-UHFFFAOYSA-N |
| SMILES | NC(N)=NC(Cc1ccccc1)C(=O)O |
| HS Code | 2925290090 |
|---|
|
~76%
2-Guanidino-3-p... CAS#:88728-27-2 |
| Literature: Jursic; Neumann; McPherson Synthesis, 2000 , # 12 p. 1656 - 1658 |
|
~%
2-Guanidino-3-p... CAS#:88728-27-2 |
| Literature: Mourgue Bulletin de la Societe Chimique de France, 1948 , p. 182 |
|
~%
2-Guanidino-3-p... CAS#:88728-27-2 |
| Literature: Kapfhammer; Mueller Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1934 , vol. 225, p. 7 |
|
~%
2-Guanidino-3-p... CAS#:88728-27-2 |
| Literature: Pant,E. Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1964 , vol. 335, p. 272 - 274 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N-carbamimidoyl-phenylalanine |
| N-Formamidine-D,L-phenylalanine |
| amidinophenylalanine |
| N-Carbamimidoyl-phenylalanin |
| 2-Guanidino-3-phenylpropanoic acid |