9H-Fluoren-9-ylmethyl pentafluorophenyl carbonate structure
|
Common Name | 9H-Fluoren-9-ylmethyl pentafluorophenyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 88744-04-1 | Molecular Weight | 406.302 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 472.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H11F5O3 | Melting Point | 85-87 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 231.0±23.6 °C | |
| Name | 9-Fluorenylmethyl pentafluorophenyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 472.6±45.0 °C at 760 mmHg |
| Melting Point | 85-87 °C(lit.) |
| Molecular Formula | C21H11F5O3 |
| Molecular Weight | 406.302 |
| Flash Point | 231.0±23.6 °C |
| Exact Mass | 406.062836 |
| PSA | 35.53000 |
| LogP | 5.78 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | CBBKZVZOEBSFQX-UHFFFAOYSA-N |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)Oc1c(F)c(F)c(F)c(F)c1F |
| Storage condition | 0-6°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | C: Corrosive;Xi: Irritant; |
| Risk Phrases | 34 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2920909090 |
|
~86%
9H-Fluoren-9-yl... CAS#:88744-04-1 |
| Literature: Synthesis, , # 4 p. 303 - 305 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Synthesis , 303, (1986)
|
| MFCD00013261 |
| Carbonic acid, 9H-fluoren-9-ylmethyl 2,3,4,5,6-pentafluorophenyl ester |
| 9H-Fluoren-9-ylmethyl pentafluorophenyl carbonate |
| 9H-fluoren-9-ylmethyl (2,3,4,5,6-pentafluorophenyl) carbonate |