Fmoc-Trp-OH structure
|
Common Name | Fmoc-Trp-OH | ||
|---|---|---|---|---|
| CAS Number | 35737-15-6 | Molecular Weight | 426.464 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 711.9±60.0 °C at 760 mmHg | |
| Molecular Formula | C26H22N2O4 | Melting Point | 182-185 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 384.3±32.9 °C | |
| Name | Nalpha-FMOC-L-Tryptophan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 711.9±60.0 °C at 760 mmHg |
| Melting Point | 182-185 °C(lit.) |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.464 |
| Flash Point | 384.3±32.9 °C |
| Exact Mass | 426.157959 |
| PSA | 91.42000 |
| LogP | 5.33 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.690 |
| InChIKey | MGHMWKZOLAAOTD-DEOSSOPVSA-N |
| SMILES | O=C(NC(Cc1c[nH]c2ccccc12)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2~8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 6 | |
|---|---|
| DownStream 8 | |
|
Design and synthesis of newN-(fluorenyl-9-methoxycarbonyl) (Fmoc)-dipeptides as anti-inflammatory agents
Eur. J. Med. Chem. 44 , 1933-40, (2009) Twenty-four new dipeptide analogs ( 1– 24) of aurantiamide acetate were designed, synthesized, and assayed for effects on superoxide anion generation and elastase release by human neutrophils in respo... |
| fmoc-D-Trp-OH |
| FMOC-TRP |
| MFCD00037126 |
| FMOC-TRYPTOPHAN |
| L-TRYPTOPHAN-N-FMOC |
| N-Fmoc-D-Trp-OH |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-tryptophan |
| Tryptophan, N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| Nalpha-FMOC-L-Trypto |
| Fmoc-Trp-OH |
| FMOC-L-TRP-OH |
| N-Fmoc-L-Trp-OH |
| N-((9H-Fluoren-9-ylmethoxy)carbonyl)-L-tryptophan |
| EINECS 252-706-5 |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]tryptophan |
| Nα-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-tryptophan |
| FMOC-L-TRP |
| N-Fmoc-D-tryptophan |
| Fmoc-D-tryptophan-OH |
| Na-(9-Fluorenylmethoxycarbonyl)-L-tryptophan |
| FMOC-L-TRYPTOPHAN-OH |
| Fmoc-L-tryptophan |
| N-Fmoc-L-Tryptophan |
| L-Tryptophan, N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| fmoc-D-Trp |
| Fmoc-D-tryptophan |
| Nα-Fmoc-L-tryptophan |