1-(4-Bromophenyl)-4-oxocyclohexanecarboxylic acid structure
|
Common Name | 1-(4-Bromophenyl)-4-oxocyclohexanecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 887978-75-8 | Molecular Weight | 297.145 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 447.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.3±28.7 °C | |
| Name | 1-(4-Bromophenyl)-4-oxocyclohexanecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 447.2±45.0 °C at 760 mmHg |
| Molecular Formula | C13H13BrO3 |
| Molecular Weight | 297.145 |
| Flash Point | 224.3±28.7 °C |
| Exact Mass | 296.004791 |
| PSA | 54.37000 |
| LogP | 2.32 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | HLQYZWCMJDKGRW-UHFFFAOYSA-N |
| SMILES | O=C1CCC(C(=O)O)(c2ccc(Br)cc2)CC1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Cyclohexanecarboxylic acid, 1-(4-bromophenyl)-4-oxo- |
| 1-(4-Bromophenyl)-4-oxocyclohexanecarboxylicAcid |
| 1-(4-Bromophenyl)-4-oxocyclohexanecarboxylic acid |