1,2,6,8-tetranitro-9H-carbazole structure
|
Common Name | 1,2,6,8-tetranitro-9H-carbazole | ||
|---|---|---|---|---|
| CAS Number | 88847-13-6 | Molecular Weight | 347.19700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H5N5O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,6,8-tetranitro-9H-carbazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H5N5O8 |
|---|---|
| Molecular Weight | 347.19700 |
| Exact Mass | 347.01400 |
| PSA | 199.07000 |
| LogP | 5.04670 |
| InChIKey | VJWZJIVIYKFFBO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2[nH]c3c([N+](=O)[O-])c([N+](=O)[O-])ccc3c2c1 |
|
~%
1,2,6,8-tetrani... CAS#:88847-13-6 |
| Literature: Murphy et al. Journal of the American Chemical Society, 1933 , vol. 75, p. 4289 |
|
~%
Detail
|
| Literature: Murphy et al. Journal of the American Chemical Society, 1933 , vol. 75, p. 4289 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 9H-Carbazole,1,2,6,8-tetranitro |
| 1,2,6,8-tetranitro-carbazole |