Benzenamine,N,N-dimethyl-4-[2-(4-pyridinyl)ethenyl]- structure
|
Common Name | Benzenamine,N,N-dimethyl-4-[2-(4-pyridinyl)ethenyl]- | ||
|---|---|---|---|---|
| CAS Number | 889-36-1 | Molecular Weight | 224.30100 | |
| Density | 1.1g/cm3 | Boiling Point | 382.6ºC at 760 mmHg | |
| Molecular Formula | C15H16N2 | Melting Point | 245-247ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 185.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N,N-dimethyl-4-(2-pyridin-4-ylethenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 382.6ºC at 760 mmHg |
| Melting Point | 245-247ºC (dec.)(lit.) |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.30100 |
| Flash Point | 185.2ºC |
| Exact Mass | 224.13100 |
| PSA | 16.13000 |
| LogP | 3.31800 |
| Index of Refraction | 1.668 |
| InChIKey | LIXUVTQYCRSIET-ONEGZZNKSA-N |
| SMILES | CN(C)c1ccc(C=Cc2ccncc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00192072 |