4-Methoxy-3-nitrobenzoic acid structure
|
Common Name | 4-Methoxy-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 89-41-8 | Molecular Weight | 197.145 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 371.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO5 | Melting Point | 192-194 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 178.5±23.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Methoxy-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 371.6±27.0 °C at 760 mmHg |
| Melting Point | 192-194 °C(lit.) |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.145 |
| Flash Point | 178.5±23.7 °C |
| Exact Mass | 197.032425 |
| PSA | 92.35000 |
| LogP | 1.75 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | ANXBDAFDZSXOPQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)O)cc1[N+](=O)[O-] |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Iridium Catalyzed Hydro-hydroxyalkylation of Butadiene: Carbonyl Crotylation.
Adv. Synth. Catal. 352(14-15) , 2416-2420, (2010) Exposure of alcohols 1a-1i to butadiene in the presence of a cyclometallated iridium catalyzed derived from allyl acetate, 4-methoxy-3-nitrobenzoic acid and BIPHEP (2,2'-bis(diphenylphosphino)biphenyl... |
|
|
Synthesis of antineoplaston A10 analogs as potential antitumor agents.
Arch. Pharm. Res. 21(2) , 157-63, (1998) Several aniline mustard analogues were obtained by introducing N,N-bis(2-chloroethyl)amino moiety to phenyl ring of A10 analogues in order to increase reactivity of A10 analogs and selectivity into DN... |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 3-nitro-p-anisic acid |
| 4-Methoxy-3-nitrobenzoic acid |
| Benzoic acid,4-methoxy-3-nitro |
| EINECS 201-906-0 |
| 4-methoxy-3-nitro-benzoic acid |
| 3-nitro-4-methoxy benzoic acid |
| MFCD00007256 |
| 3-Nitro-anissaeure |
| 4-Methoxy-3-nitro-benzoesaeure |