4,2-chloronitrotoluene structure
|
Common Name | 4,2-chloronitrotoluene | ||
|---|---|---|---|---|
| CAS Number | 89-59-8 | Molecular Weight | 171.581 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 238.5±20.0 °C at 760 mmHg | |
| Molecular Formula | C7H6ClNO2 | Melting Point | 35 °C | |
| MSDS | Chinese USA | Flash Point | 98.1±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Chloro-2-nitrotoluene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 238.5±20.0 °C at 760 mmHg |
| Melting Point | 35 °C |
| Molecular Formula | C7H6ClNO2 |
| Molecular Weight | 171.581 |
| Flash Point | 98.1±21.8 °C |
| Exact Mass | 171.008713 |
| PSA | 45.82000 |
| LogP | 3.10 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | SQFLFRQWPBEDHM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)cc1[N+](=O)[O-] |
| Water Solubility | 109 mg/L (20 ºC) |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36-S36/37/39-S61 |
| RIDADR | UN 3457 6.1/PG 3 |
| WGK Germany | 2 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2904909090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Synthesis of tricyclic indole-2-carboxylic [correction of caboxylic] acids as potent NMDA-glycine antagonists.
J. Org. Chem. 66(10) , 3474-83, (2001) The practical synthesis of a series of tricyclic indole-2-carboxylic acids, 7-chloro-3-arylaminocarbonylmethyl-1,3,4,5-tetrahydrobenz[cd]indole-2-carboxylic acids, as a new class of potent NMDA-glycin... |
|
|
Raman spectroscopic and structural studies of indigo and its four 6,6'-dihalogeno analogues.
Analyst 129(7) , 613-618, (2004) The Raman and electron impact mass spectra of synthetic indigo and its four 6,6'-dihalogeno analogues are reported and discussed. The influence of varying the halogen on these Raman spectra is conside... |
|
|
Monitoring of priority pesticides and other organic pollutants in river water from portugal by gas chromatography-mass spectrometry and liquid chromatography-atmospheric pressure chemical ionization mass spectrometry.
J. Chromatogr. A. 879(1) , 13-26, (2000) Gas chromatography-mass spectrometry (GC-MS) and liquid chromatography-atmospheric pressure chemical ionization mass spectrometry (LC-APCI-MS) were optimized and applied for the trace-level determinat... |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4,2-chloronitrotoluene |
| EINECS 201-921-2 |
| Toluene,4-chloro-2-nitro |
| 4-Chlor-2-nitrotoluol |
| MFCD00007215 |
| 4-Chloro-2-nitrotolu |
| 4-Chloro-2-nitrotoluene |
| 4-Chloro-2-Nitorotoluene |
| 2-Nitro-4-chlorotoluene |
| 4-chloro-nitrotoluene |
| 1-chloro-4-methyl-3-nitrobenzene |
| p-Chloro-o-nitrotoluene |
| o-Nitro-p-chlorotoluene |
| 4-Chloro-1-methyl-2-nitrobenzene |
| 4-chloro-2-nitro-toluene |