2,3-dimethoxy-5-methyl-6-(morpholin-4-ylmethyl)benzene-1,4-diol structure
|
Common Name | 2,3-dimethoxy-5-methyl-6-(morpholin-4-ylmethyl)benzene-1,4-diol | ||
|---|---|---|---|---|
| CAS Number | 89048-26-0 | Molecular Weight | 283.32000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-dimethoxy-5-methyl-6-(morpholin-4-ylmethyl)benzene-1,4-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H21NO5 |
|---|---|
| Molecular Weight | 283.32000 |
| Exact Mass | 283.14200 |
| PSA | 71.39000 |
| LogP | 1.19350 |
| InChIKey | FTXRJHDFGZZHED-UHFFFAOYSA-N |
| SMILES | COc1c(O)c(C)c(CN2CCOCC2)c(O)c1OC |
|
~66%
2,3-dimethoxy-5... CAS#:89048-26-0 |
| Literature: Okamoto; Matsumoto; Watanabe; Kawada; Imamoto; Imada Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 9 p. 3745 - 3755 |
|
~%
2,3-dimethoxy-5... CAS#:89048-26-0 |
| Literature: Okamoto; Matsumoto; Watanabe; Kawada; Imamoto; Imada Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 9 p. 3745 - 3755 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 2,3-dimethoxy-5-methyl-6-morpholinomethylhydroquinone |
| 1,4-Benzenediol,2,3-dimethoxy-5-methyl-6-(4-morpholinylmethyl) |