4,4-dimethyl-2-phenyl-1-oxa-3-aza-2$l^C10H14NO2P-phosphacyclopentane 2-oxide structure
|
Common Name | 4,4-dimethyl-2-phenyl-1-oxa-3-aza-2$l^C10H14NO2P-phosphacyclopentane 2-oxide | ||
|---|---|---|---|---|
| CAS Number | 89277-92-9 | Molecular Weight | 211.19700 | |
| Density | 1.18g/cm3 | Boiling Point | 283.6ºC at 760 mmHg | |
| Molecular Formula | C10H14NO2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.3ºC | |
| Name | 4,4-dimethyl-2-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 283.6ºC at 760 mmHg |
| Molecular Formula | C10H14NO2P |
| Molecular Weight | 211.19700 |
| Flash Point | 125.3ºC |
| Exact Mass | 211.07600 |
| PSA | 48.14000 |
| LogP | 2.23220 |
| Index of Refraction | 1.536 |
| InChIKey | POERAVHYGNNNIY-UHFFFAOYSA-N |
| SMILES | CC1(C)COP(=O)(c2ccccc2)N1 |
|
~%
4,4-dimethyl-2-... CAS#:89277-92-9 |
| Literature: Cates; Li; Yakshe; et al. Journal of Medicinal Chemistry, 1984 , vol. 27, # 5 p. 654 - 659 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-phenyl-4,4-dimethyl-1,3,2-oxazaphospholidine 2-oxide |
| 4,4-dimethyl-2-phenyl-1,3,2 |