2-Anilino-6-dibutylamino-3-methylfluoran structure
|
Common Name | 2-Anilino-6-dibutylamino-3-methylfluoran | ||
|---|---|---|---|---|
| CAS Number | 89331-94-2 | Molecular Weight | 532.672 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 704.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C35H36N2O3 | Melting Point | 179-184ºC | |
| MSDS | N/A | Flash Point | 379.8±32.9 °C | |
| Name | 2-Anilino-6-dibutylamino-3-methylfluoran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 704.5±60.0 °C at 760 mmHg |
| Melting Point | 179-184ºC |
| Molecular Formula | C35H36N2O3 |
| Molecular Weight | 532.672 |
| Flash Point | 379.8±32.9 °C |
| Exact Mass | 532.272583 |
| PSA | 50.80000 |
| LogP | 8.80 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | XAAILNNJDMIMON-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)Oc1cc(C)c(Nc3ccccc3)cc1C21OC(=O)c2ccccc21 |
|
~95%
2-Anilino-6-dib... CAS#:89331-94-2 |
| Literature: Yanagita, Mitsuhiro; Aoki, Izuo; Tokita, Sumio Bulletin of the Chemical Society of Japan, 1997 , vol. 70, # 11 p. 2757 - 2763 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| MFCD00307579 |
| 6'-(dibutylamino)-3'-methyl-2'-(phenylamino)-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| T C666 BO IXJ E1 FMR& MN4&4 I-& DT56 BVOXJ |
| Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 6'-(dibutylamino)-3'-methyl-2'-(phenylamino)- |
| 2-Phenylamino-3-methyl-6-di-n-butylaminofluoran 3-Di-n-butylamino-6-methyl-7-phenylaminofluoran odb-two |
| 6'-(Dibutylamino)-3'-methyl-2'-(phenylamino)-3H-spiro[2-benzofuran-1,9'-xanthen]-3-on |
| Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one-6'-(dibutylamino)-3'-methyl-2'-(phenylamino)- |
| 2'-Anilino-6'-(dibutylamino)-3'-methyl-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| EINECS 403-830-5 |
| UNII:2H1E1033W1 |
| 2'-anilino-6'-(dibutylamino)-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| 2-phenylamino-3-methyl-6-dibutylaminofluorane |