2-Anilino-6-dibutylamino-3-methylfluoran
2-Anilino-6-dibutylamino-3-methylfluoran structure
|
Common Name | 2-Anilino-6-dibutylamino-3-methylfluoran | ||
|---|---|---|---|---|
| CAS Number | 89331-94-2 | Molecular Weight | 532.672 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 704.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C35H36N2O3 | Melting Point | 179-184ºC | |
| MSDS | N/A | Flash Point | 379.8±32.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Anilino-6-dibutylamino-3-methylfluoran |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 704.5±60.0 °C at 760 mmHg |
| Melting Point | 179-184ºC |
| Molecular Formula | C35H36N2O3 |
| Molecular Weight | 532.672 |
| Flash Point | 379.8±32.9 °C |
| Exact Mass | 532.272583 |
| PSA | 50.80000 |
| LogP | 8.80 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | XAAILNNJDMIMON-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)Oc1cc(C)c(Nc3ccccc3)cc1C21OC(=O)c2ccccc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~95%
2-Anilino-6-dib... CAS#:89331-94-2 |
| Literature: Yanagita, Mitsuhiro; Aoki, Izuo; Tokita, Sumio Bulletin of the Chemical Society of Japan, 1997 , vol. 70, # 11 p. 2757 - 2763 |
![2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid structure](https://image.chemsrc.com/caspic/293/54574-82-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD00307579 |
| 6'-(dibutylamino)-3'-methyl-2'-(phenylamino)-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| T C666 BO IXJ E1 FMR& MN4&4 I-& DT56 BVOXJ |
| 2-Phenylamino-3-methyl-6-di-n-butylaminofluoran 3-Di-n-butylamino-6-methyl-7-phenylaminofluoran odb-two |
| 6'-(Dibutylamino)-3'-methyl-2'-(phenylamino)-3H-spiro[2-benzofuran-1,9'-xanthen]-3-on |
| 2'-Anilino-6'-(dibutylamino)-3'-methyl-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| EINECS 403-830-5 |
| UNII:2H1E1033W1 |
| 2'-anilino-6'-(dibutylamino)-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| 2-phenylamino-3-methyl-6-dibutylaminofluorane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-Anilino-6-dibutylamino-3-methylfluoran? |
| A: Molecular formula of 2-Anilino-6-dibutylamino-3-methylfluoran is C35H36N2O3. |
| Q: What is the LogP of 2-Anilino-6-dibutylamino-3-methylfluoran? |
| A: LogP of 2-Anilino-6-dibutylamino-3-methylfluoran is 8.80. |
| Q: What is the molecular weight of 2-Anilino-6-dibutylamino-3-methylfluoran? |
| A: Molecular weight of 2-Anilino-6-dibutylamino-3-methylfluoran is 532.672. |
| Q: What is the boiling point of 2-Anilino-6-dibutylamino-3-methylfluoran? |
| A: Boiling point of 2-Anilino-6-dibutylamino-3-methylfluoran is 704.5±60.0 °C at 760 mmHg. |
| Q: What are the upstream materials of 2-Anilino-6-dibutylamino-3-methylfluoran? |
| A: Related upstream materials(CAS) of 2-Anilino-6-dibutylamino-3-methylfluoran: 41317-15-1;54574-82-2. |
| Q: What is the SMILES notation of 2-Anilino-6-dibutylamino-3-methylfluoran? |
| A: SMILES notation of 2-Anilino-6-dibutylamino-3-methylfluoran is CCCCN(CCCC)c1ccc2c(c1)Oc1cc(C)c(Nc3ccccc3)cc1C21OC(=O)c2ccccc21. |
| Q: What is the safety information for 2-Anilino-6-dibutylamino-3-methylfluoran? |
| A: Safety information for 2-Anilino-6-dibutylamino-3-methylfluoran: 61. |
| Q: What is the English name of 2-Anilino-6-dibutylamino-3-methylfluoran? |
| A: The English name of 2-Anilino-6-dibutylamino-3-methylfluoran is 2-Anilino-6-dibutylamino-3-methylfluoran. |
| Q: What is the polar surface area (PSA) of 2-Anilino-6-dibutylamino-3-methylfluoran? |
| A: Polar surface area (PSA) of 2-Anilino-6-dibutylamino-3-methylfluoran is 50.80000. |
| Q: What is the InChIKey of 2-Anilino-6-dibutylamino-3-methylfluoran? |
| A: InChIKey of 2-Anilino-6-dibutylamino-3-methylfluoran is XAAILNNJDMIMON-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |