2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid structure
|
Common Name | 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 54574-82-2 | Molecular Weight | 369.454 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 570.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C22H27NO4 | Melting Point | 190-193 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 298.6±28.7 °C | |
| Name | 2-[4-(Dibutylamino)-2-Hydroxybenzoyl]Benzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 570.2±45.0 °C at 760 mmHg |
| Melting Point | 190-193 °C(lit.) |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.454 |
| Flash Point | 298.6±28.7 °C |
| Exact Mass | 369.194000 |
| PSA | 77.84000 |
| LogP | 6.10 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | QPNFUBAIQZJEPO-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)c1ccc(C(=O)c2ccccc2C(=O)O)c(O)c1 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
A highly selective and sensitive colorimetric chemosensor for Fe(2+) based on fluoran dye.
Spectrochim. Acta. A. Mol. Biomol. Spectrosc. 76(3-4) , 293-6, (2010) A highly selective chemosensor based on fluoran dye for Fe(2+), 2'-anilino-3'-methyl-6'-dibuthylamino-N-((2'-(2''-ethylimino) methyl) naphthalen-2-ol) iso-indolin-1-one-fluoran (5), was designed and s... |
| MFCD00134670 |
| 2-{[4-(dibutylamino)-2-hydroxyphenyl]carbonyl}benzoic acid |
| Benzoic acid, 2-[4-(dibutylamino)-2-hydroxybenzoyl]- |
| 2-[4-(Dibutylamino)-2-hydroxybenzoyl]benzoic acid |
| EINECS 410-410-5 |