2,6-Dichlorophenyl-(1H-pyrrol-3-yl)methanone structure
|
Common Name | 2,6-Dichlorophenyl-(1H-pyrrol-3-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 893612-69-6 | Molecular Weight | 240.08500 | |
| Density | 1.414g/cm3 | Boiling Point | 406.1ºC at 760 mmHg | |
| Molecular Formula | C11H7Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4ºC | |
| Name | (2,6-dichlorophenyl)-(1H-pyrrol-3-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.414g/cm3 |
|---|---|
| Boiling Point | 406.1ºC at 760 mmHg |
| Molecular Formula | C11H7Cl2NO |
| Molecular Weight | 240.08500 |
| Flash Point | 199.4ºC |
| Exact Mass | 238.99000 |
| PSA | 32.86000 |
| LogP | 3.55250 |
| Index of Refraction | 1.628 |
| InChIKey | FLNZXANJCXCHQJ-UHFFFAOYSA-N |
| SMILES | O=C(c1cc[nH]c1)c1c(Cl)cccc1Cl |
| Hazard Codes | C: Corrosive; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| OR1377 |
| 2,6-DICHLOROPHENYL-(1H-PYRROL-3-YL)METHANONE |
| GL-0660 |
| 3-(2,6-Dichlorobenzoyl)-1H-pyrrole |