2-(1,3-Benzodioxol-5-yl)indolizine-3-carboxaldehyde structure
|
Common Name | 2-(1,3-Benzodioxol-5-yl)indolizine-3-carboxaldehyde | ||
|---|---|---|---|---|
| CAS Number | 893612-89-0 | Molecular Weight | 265.26300 | |
| Density | 1.34g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,3-benzodioxol-5-yl)indolizine-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.26300 |
| Exact Mass | 265.07400 |
| PSA | 39.94000 |
| LogP | 3.14750 |
| Index of Refraction | 1.67 |
| InChIKey | XMLWUCQDJAEAPX-UHFFFAOYSA-N |
| SMILES | O=Cc1c(-c2ccc3c(c2)OCO3)cc2ccccn12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| or1972 |
| 2,6-di-tert-butyl-p-benzoquinone |