Me-triacetyl-β-D-glucopyranuronate-Ph-CH2OH-Fmoc
Modify Date: 2025-08-24 14:39:08
Me-triacetyl-β-D-glucopyranuronate-Ph-CH2OH-Fmoc structure
|
Common Name | Me-triacetyl-β-D-glucopyranuronate-Ph-CH2OH-Fmoc | ||
|---|---|---|---|---|
| CAS Number | 894096-02-7 | Molecular Weight | 748.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H40N2O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Me-triacetyl-β-D-glucopyranuronate-Ph-CH2OH-FmocMe-triacetyl-β-D-glucopyranuronate-Ph-CH2OH-Fmoc is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Me-triacetyl-β-D-glucopyranuronate-Ph-CH2OH-Fmoc |
|---|
| Description | Me-triacetyl-β-D-glucopyranuronate-Ph-CH2OH-Fmoc is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C38H40N2O14 |
|---|---|
| Molecular Weight | 748.73 |
| InChIKey | COFWDBMZXNIYIR-DVEMFWCFSA-N |
| SMILES | COC(=O)C1OC(Oc2ccc(CO)cc2NC(=O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| Storage condition | 2-8°C |