2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide
![2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide Structure](https://image.chemsrc.com/caspic/061/89650-74-8.png)
2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide structure
|
Common Name | 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 89650-74-8 | Molecular Weight | 228.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H12N2O2 |
|---|---|
| Molecular Weight | 228.24700 |
| Exact Mass | 228.09000 |
| PSA | 66.08000 |
| LogP | 2.40520 |
| InChIKey | NGQWJBXZOXYCQK-UHFFFAOYSA-N |
| SMILES | NC(=O)Cc1c2n(c3ccccc13)C(=O)CC2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~95%
2-(1-oxo-2,3-di... CAS#:89650-74-8 |
| Literature: Ban, Yoshio; Yoshida, Kiyoshi; Goto, Jiro; Oishi, Takeshi; Takeda, Eiko; Ishigamori Tetrahedron, 1983 , vol. 39, # 22 p. 3657 - 3668 |
|
~%
2-(1-oxo-2,3-di... CAS#:89650-74-8 |
| Literature: Ban, Yoshio; Yoshida, Kiyoshi; Goto, Jiro; Oishi, Takeshi; Takeda, Eiko; Ishigamori Tetrahedron, 1983 , vol. 39, # 22 p. 3657 - 3668 |
|
~%
2-(1-oxo-2,3-di... CAS#:89650-74-8 |
| Literature: Ban, Yoshio; Yoshida, Kiyoshi; Goto, Jiro; Oishi, Takeshi; Takeda, Eiko; Ishigamori Tetrahedron, 1983 , vol. 39, # 22 p. 3657 - 3668 |
|
~%
2-(1-oxo-2,3-di... CAS#:89650-74-8 |
| Literature: Ban, Yoshio; Yoshida, Kiyoshi; Goto, Jiro; Oishi, Takeshi; Takeda, Eiko; Ishigamori Tetrahedron, 1983 , vol. 39, # 22 p. 3657 - 3668 |
![(3-Oxo-2,3-dihydro-1H-pyrrolo[1,2-a]indol-9-yl)-acetyl chloride structure](https://image.chemsrc.com/caspic/023/89650-75-9.png)
![2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetic acid structure](https://image.chemsrc.com/caspic/099/89650-73-7.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-oxo-9-carbamoylmethyl-1,2-dihydro-3H-pyrrolo<1,2-a>indole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide? |
| A: Molecular formula of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide is C13H12N2O2. |
| Q: What is the SMILES notation of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide? |
| A: SMILES notation of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide is NC(=O)Cc1c2n(c3ccccc13)C(=O)CC2. |
| Q: What is the molecular weight of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide? |
| A: Molecular weight of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide is 228.24700. |
| Q: What English synonyms does 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide have? |
| A: English synonyms of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide: 3-oxo-9-carbamoylmethyl-1,2-dihydro-3H-pyrroloindole. |
| Q: What is the InChIKey of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide? |
| A: InChIKey of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide is NGQWJBXZOXYCQK-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide? |
| A: LogP of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide is 2.40520. |
| Q: What is the Chinese name of 89650-74-8? |
| A: Chinese name of 89650-74-8 is 89650-74-8. |
| Q: What is the polar surface area (PSA) of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide? |
| A: Polar surface area (PSA) of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide is 66.08000. |
| Q: What is the CAS number of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide? |
| A: CAS number of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide is 89650-74-8. |
| Q: What is the English name of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide? |
| A: The English name of 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide is 2-(1-oxo-2,3-dihydropyrrolo[1,2-a]indol-4-yl)acetamide. |