2-(4-Fluorophenyl)-5-[(5-iodo-2-Methylphenyl)methyl]thiophene structure
|
Common Name | 2-(4-Fluorophenyl)-5-[(5-iodo-2-Methylphenyl)methyl]thiophene | ||
|---|---|---|---|---|
| CAS Number | 898566-17-1 | Molecular Weight | 408.272 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 450.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H14FIS | Melting Point | 107-110°C | |
| MSDS | USA | Flash Point | 226.1±28.7 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-(4-Fluorophenyl)-5-[(5-iodo-2-Methylphenyl)methyl]thiophene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 450.2±45.0 °C at 760 mmHg |
| Melting Point | 107-110°C |
| Molecular Formula | C18H14FIS |
| Molecular Weight | 408.272 |
| Flash Point | 226.1±28.7 °C |
| Exact Mass | 407.984497 |
| PSA | 28.24000 |
| LogP | 7.20 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | MGXZKAYHSITHMW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(I)cc1Cc1ccc(-c2ccc(F)cc2)s1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318-H413 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
|
~%
2-(4-Fluorophen... CAS#:898566-17-1 |
| Literature: WO2009/35969 A1, ; Page/Page column 77 ; WO 2009/035969 A1 |
|
~%
2-(4-Fluorophen... CAS#:898566-17-1 |
| Literature: US2010/99883 A1, ; Page/Page column 40-41 ; US 20100099883 A1 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-Fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene |
| T5SJ B1R CI F1& ER DF |
| 2-(5-iodo-2-methylbenzyl)-5-(4-fluoro-phenyl)thiophene |
| THI045 |
| 2-(4-Fluorophenyl)-5-(5-iodo-2-methylbenzyl)thiophene |
| Thiophene, 2-(4-fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]- |