ML348 structure
|
Common Name | ML348 | ||
|---|---|---|---|---|
| CAS Number | 899713-86-1 | Molecular Weight | 415.794 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 546.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H17ClF3N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.2±30.1 °C | |
Use of ML348ML348 is a selective and reversible lysophospholipase 1 (LYPLA1) inhibitor (IC50 = 210 nM), Exhibits 14-fold selectivity for LYPLA1 over LYPLA2, Also selective over a panel of ~30 other serine hydrolases.target: LYPLA1 [1]IC 50: 210 nM [1] |
| Name | N-[2-Chloro-5-(trifluoromethyl)phenyl]-2-[4-(2-furoyl)-1-piperazinyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Description | ML348 is a selective and reversible lysophospholipase 1 (LYPLA1) inhibitor (IC50 = 210 nM), Exhibits 14-fold selectivity for LYPLA1 over LYPLA2, Also selective over a panel of ~30 other serine hydrolases.target: LYPLA1 [1]IC 50: 210 nM [1] |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 546.2±50.0 °C at 760 mmHg |
| Molecular Formula | C18H17ClF3N3O3 |
| Molecular Weight | 415.794 |
| Flash Point | 284.2±30.1 °C |
| Exact Mass | 415.091064 |
| LogP | 3.28 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | OXKNHBBDOIMFFQ-UHFFFAOYSA-N |
| SMILES | O=C(CN1CCN(C(=O)c2ccco2)CC1)Nc1cc(C(F)(F)F)ccc1Cl |
| Storage condition | 2-8℃ |
| 1-Piperazineacetamide, N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(2-furanylcarbonyl)- |
| N-[2-Chloro-5-(trifluoromethyl)phenyl]-2-[4-(2-furoyl)-1-piperazinyl]acetamide |
| ML-348 |
| ML348 |