Peimisine hydrochloride
Modify Date: 2025-08-26 07:22:20
Peimisine hydrochloride structure
|
Common Name | Peimisine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 900498-44-4 | Molecular Weight | 464.080 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H42ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Peimisine hydrochloridePeimisine (Ebeiensine) hydrochloride non-competitively antagonizes tracheal smooth muscle muscarinic M receptor and inhibits smooth muscle contraction caused by Ach. Peimisine hydrochloride excits β-receptor, restrains the release of internal calcium, and promotes to releaseing NO in order to relax tracheal smooth muscle and relieve asthma[1]. |
| Name | Peimisine hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Peimisine (Ebeiensine) hydrochloride non-competitively antagonizes tracheal smooth muscle muscarinic M receptor and inhibits smooth muscle contraction caused by Ach. Peimisine hydrochloride excits β-receptor, restrains the release of internal calcium, and promotes to releaseing NO in order to relax tracheal smooth muscle and relieve asthma[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H42ClNO3 |
|---|---|
| Molecular Weight | 464.080 |
| Exact Mass | 463.285309 |
| InChIKey | BVYFGCQMQQGAEY-MCZYSGEJSA-N |
| SMILES | CC1=C2CC3C(CC(=O)C4CC(O)CCC43C)C2CCC12OC1CC(C)CNC1C2C.Cl |
| Spiro[9H-benzo[a]fluorene-9,2'(3'H)-furo[3,2-b]pyridin]-5(6H)-one, 1,2,3,3'a,4,4',4a,5',6',6a,6b,7,7',7'a,8,11,11a,11b-octadecahydro-3-hydroxy-3',6',10,11b-tetramethyl-, (3S,3'R,3a'S,4aS,6'S,6aR,6bS,7a'R,9R,11aS,11bR)-, hydrochloride (1:1) |
| (3β,5α,22S,23R)-3-Hydroxy-5,6-dihydro-17,23-epoxyveratraman-6-one hydrochloride (1:1) |