2-Methoxy-5-(Methoxycarbonyl)benzoic acid structure
|
Common Name | 2-Methoxy-5-(Methoxycarbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 90183-43-0 | Molecular Weight | 210.18300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methoxy-5-methoxycarbonylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10O5 |
|---|---|
| Molecular Weight | 210.18300 |
| Exact Mass | 210.05300 |
| PSA | 72.83000 |
| LogP | 1.18000 |
| InChIKey | OSJPAIKJBQLCSE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OC)c(C(=O)O)c1 |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,3-Benzenedicarboxylic acid,4-methoxy-,1-methyl ester |