2-methoxy-5-(trifluoromethoxy)benzoic acid structure
|
Common Name | 2-methoxy-5-(trifluoromethoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 191604-88-3 | Molecular Weight | 236.14500 | |
| Density | 1.419g/cm3 | Boiling Point | 283.7ºC at 760mmHg | |
| Molecular Formula | C9H7F3O4 | Melting Point | 63-65°C | |
| MSDS | USA | Flash Point | N/A | |
| Name | 2-methoxy-5-(trifluoromethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.419g/cm3 |
|---|---|
| Boiling Point | 283.7ºC at 760mmHg |
| Melting Point | 63-65°C |
| Molecular Formula | C9H7F3O4 |
| Molecular Weight | 236.14500 |
| Exact Mass | 236.03000 |
| PSA | 55.76000 |
| LogP | 2.29200 |
| Vapour Pressure | 0.00146mmHg at 25°C |
| Index of Refraction | 1.476 |
| InChIKey | HURBWIHJHDFCGU-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC(F)(F)F)cc1C(=O)O |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2918990090 |
|
~%
Detail
|
| Literature: US2001/34343 A1, ; |
|
~89%
2-methoxy-5-(tr... CAS#:191604-88-3 |
| Literature: Castagnetti, Eva; Schlosser, Manfred Chemistry - A European Journal, 2002 , vol. 8, # 4 p. 799 - 804 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD01862055 |
| 3-trifluoromethoxy-6-methoxybenzoic acid |
| 2-methoxy-5-trifluoromethoxybenzoic acid |