1-[4-(methoxymethyl-methyl-amino)diazenylphenyl]ethanone structure
|
Common Name | 1-[4-(methoxymethyl-methyl-amino)diazenylphenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 90476-20-3 | Molecular Weight | 221.25600 | |
| Density | 1.09g/cm3 | Boiling Point | 328.2ºC at 760 mmHg | |
| Molecular Formula | C11H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.3ºC | |
| Name | 1-[4-[[methoxymethyl(methyl)amino]diazenyl]phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 328.2ºC at 760 mmHg |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.25600 |
| Flash Point | 152.3ºC |
| Exact Mass | 221.11600 |
| PSA | 54.26000 |
| LogP | 2.42360 |
| Index of Refraction | 1.528 |
| InChIKey | KKLFFZPMEQDZNJ-UHFFFAOYSA-N |
| SMILES | COCN(C)N=Nc1ccc(C(C)=O)cc1 |
|
~74%
1-[4-(methoxyme... CAS#:90476-20-3 |
| Literature: Hemens, Chantal M.; Manning, Hartford W.; Vaughan, Keith; LaFrance, Ronald; Tang, York Canadian Journal of Chemistry, 1984 , vol. 62, p. 741 - 748 |
|
~%
1-[4-(methoxyme... CAS#:90476-20-3 |
| Literature: Hemens, Chantal M.; Manning, Hartford W.; Vaughan, Keith; LaFrance, Ronald; Tang, York Canadian Journal of Chemistry, 1984 , vol. 62, p. 741 - 748 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-p-acetylphenyl-3-methyl-3-methoxymethyltriazene |