[(4-acetylphenyl)diazenyl-methyl-amino]methyl acetate structure
|
Common Name | [(4-acetylphenyl)diazenyl-methyl-amino]methyl acetate | ||
|---|---|---|---|---|
| CAS Number | 90476-11-2 | Molecular Weight | 249.26600 | |
| Density | 1.15g/cm3 | Boiling Point | 369.3ºC at 760 mmHg | |
| Molecular Formula | C12H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.1ºC | |
| Name | [[(4-acetylphenyl)diazenyl]-methylamino]methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 369.3ºC at 760 mmHg |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.26600 |
| Flash Point | 177.1ºC |
| Exact Mass | 249.11100 |
| PSA | 71.33000 |
| LogP | 2.34030 |
| Index of Refraction | 1.541 |
| InChIKey | AYNKZSHXOVSFOS-UHFFFAOYSA-N |
| SMILES | CC(=O)OCN(C)N=Nc1ccc(C(C)=O)cc1 |
|
~61%
[(4-acetylpheny... CAS#:90476-11-2 |
| Literature: Hemens, Chantal M.; Manning, Hartford W.; Vaughan, Keith; LaFrance, Ronald; Tang, York Canadian Journal of Chemistry, 1984 , vol. 62, p. 741 - 748 |
| Ethanone,1-[4-[3-[(acetoxy)methyl]-3-methyl-1-triazenyl] phenyl] |
| 1-p-acetylphenyl-3-methyl-3-acetoxymethyltriazene |