m-PEG10-CH2COOH structure
|
Common Name | m-PEG10-CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 908258-58-2 | Molecular Weight | 530.60400 | |
| Density | 1.122 | Boiling Point | N/A | |
| Molecular Formula | C23H46O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of m-PEG10-CH2COOHm-PEG10-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG10-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.122 |
|---|---|
| Molecular Formula | C23H46O13 |
| Molecular Weight | 530.60400 |
| Exact Mass | 530.29400 |
| PSA | 138.83000 |
| InChIKey | DNJQYLLQMMESPG-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCC(=O)O |
|
~%
m-PEG10-CH2COOH CAS#:908258-58-2 |
| Literature: Heidkamp, Katharina; Aytemir, Memet; Vorlop, Klaus-Dieter; Pruesse, Ulf Catalysis Science and Technology, 2013 , vol. 3, # 11 p. 2984 - 2992 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (2-{2-[2-(2-{2-[2-(2-{2-[2-(2-methoxyethoxy)ethoxy]ethoxy}ethoxy)ethoxy]ethoxy}ethoxy)ethoxy]-ethoxy}ethoxy)acetic acid |
| 3,6,9,12,15,18,21,24,27,30,33-UNDECAOXATETRATRIACONTANOIC ACID |