2-(Chloromethyl)-1,4-bis(trifluoromethyl)benzene structure
|
Common Name | 2-(Chloromethyl)-1,4-bis(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 911060-71-4 | Molecular Weight | 262.57900 | |
| Density | 1.425g/cm3 | Boiling Point | 185.9ºC at 760 mmHg | |
| Molecular Formula | C9H5ClF6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 82.2ºC | |
| Name | 2-(Chloromethyl)-1,4-bis(trifluoromethyl)benzene |
|---|
| Density | 1.425g/cm3 |
|---|---|
| Boiling Point | 185.9ºC at 760 mmHg |
| Molecular Formula | C9H5ClF6 |
| Molecular Weight | 262.57900 |
| Flash Point | 82.2ºC |
| Exact Mass | 261.99800 |
| LogP | 4.46300 |
| Index of Refraction | 1.413 |
| InChIKey | NFRNXRHGNOIVOT-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(C(F)(F)F)c(CCl)c1 |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |