2-ethynyl-1,4-bis(trifluoromethyl)benzene structure
|
Common Name | 2-ethynyl-1,4-bis(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 88444-78-4 | Molecular Weight | 238.12900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H4F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethynyl-1,4-bis(trifluoromethyl)benzene |
|---|
| Molecular Formula | C10H4F6 |
|---|---|
| Molecular Weight | 238.12900 |
| Exact Mass | 238.02200 |
| LogP | 3.70550 |
| InChIKey | RENRBYCWFFOHIG-UHFFFAOYSA-N |
| SMILES | C#Cc1cc(C(F)(F)F)ccc1C(F)(F)F |
|
~%
2-ethynyl-1,4-b... CAS#:88444-78-4 |
| Literature: Kodaira, Kazuo; Okuhara, Kunio Bulletin of the Chemical Society of Japan, 1988 , vol. 61, # 5 p. 1625 - 1632 |
|
~%
2-ethynyl-1,4-b... CAS#:88444-78-4 |
| Literature: Okuhara, K.; Kodaira, K. Journal of Fluorine Chemistry, 1983 , vol. 23, p. 497 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |