2-cyano-3-(4-hydroxy-3-methoxy-phenyl)prop-2-enamide structure
|
Common Name | 2-cyano-3-(4-hydroxy-3-methoxy-phenyl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 91138-32-8 | Molecular Weight | 218.20900 | |
| Density | 1.336g/cm3 | Boiling Point | 488.8ºC at 760 mmHg | |
| Molecular Formula | C11H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.4ºC | |
| Name | 2-cyano-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 488.8ºC at 760 mmHg |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.20900 |
| Flash Point | 249.4ºC |
| Exact Mass | 218.06900 |
| PSA | 96.34000 |
| LogP | 1.49338 |
| Index of Refraction | 1.637 |
| InChIKey | XGWRIMMSDUGXTL-YWEYNIOJSA-N |
| SMILES | COc1cc(C=C(C#N)C(N)=O)ccc1O |
|
~68%
2-cyano-3-(4-hy... CAS#:91138-32-8 |
| Literature: Reddy, T. Indrasena; Varma, Rajender S. Tetrahedron Letters, 1997 , vol. 38, # 10 p. 1721 - 1724 |
|
~%
2-cyano-3-(4-hy... CAS#:91138-32-8 |
| Literature: Piccinini Chem. Zentralbl., 1904 , vol. 75, # II p. 902 |
|
~%
2-cyano-3-(4-hy... CAS#:91138-32-8 |
| Literature: Zimmer and Co. Patent: DE101684 ; |
| 2-cyano-3-(4-hydroxy-3-methoxy-phenyl)-acrylic acid |
| 4-Oxy-3-methoxy-benzalmalonsaeure-mononitril |
| 4-Oxy-3-methoxy-benzalmalonsaeure-amid-nitril |
| Vanillylidencyanessigsaeure-amid |
| 2-Cyan-3-(4-hydroxy-3-methoxy-phenyl)-acrylsaeure-amid |
| Vanillylidencyanessigsaeure |
| 2-Cyan-3-(4-hydroxy-3-methoxy-phenyl)-acrylsaeure |
| 2-cyano-3-(4-hydroxy-3-methoxy-phenyl)-acrylic acid amide |
| Vanillalcyanessigsaeure |
| Vanillalcyanacetamid |
| 4-Oxy-3-methoxy-benzylidencyanessigsaeure |