3-Chloro-4-fluorobenzenesulfonyl chloride structure
|
Common Name | 3-Chloro-4-fluorobenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 91170-93-3 | Molecular Weight | 229.056 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 308.1±27.0 °C at 760 mmHg | |
| Molecular Formula | C6H3Cl2FO2S | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 140.2±23.7 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 3-Chloro-4-fluorobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 308.1±27.0 °C at 760 mmHg |
| Molecular Formula | C6H3Cl2FO2S |
| Molecular Weight | 229.056 |
| Flash Point | 140.2±23.7 °C |
| Exact Mass | 227.921478 |
| PSA | 42.52000 |
| LogP | 3.37 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | DXFXNSNBZNELII-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(F)c(Cl)c1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-Chloro-4-fluorobenzenesulphonyl chloride |
| WSGR CG DF |
| Benzenesulfonyl chloride, 3-chloro-4-fluoro- |
| MFCD00041444 |
| 3-Chloro-4-fluorobenzenesulfonyl chloride |